C11H15F2NO3S — CID 81270109
2-(2,6-difluorophenoxy)-N-(2-methylsulfonylethyl)ethanamine (PubChem CID 81270109) has the molecular formula C11H15F2NO3S and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-(2,6-difluorophenoxy)-N-(2-methylsulfonylethyl)ethanamine.
| Compound Name | 2-(2,6-difluorophenoxy)-N-(2-methylsulfonylethyl)ethanamine |
|---|---|
| PubChem CID | 81270109 |
| Molecular Formula | C11H15F2NO3S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-(2,6-difluorophenoxy)-N-(2-methylsulfonylethyl)ethanamine |
| SMILES | CS(=O)(=O)CCNCCOc1c(F)cccc1F |
| InChI | InChI=1S/C11H15F2NO3S/c1-18(15,16)8-6-14-5-7-17-11-9(12)3-2-4-10(11)13/h2-4,14H,5-8H2,1H3 |
| InChIKey | FVNHBZATHKCIGH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|