C13H20ClNO3S — CID 62584689
2-(4-chloro-3,5-dimethylphenoxy)-N-(2-methylsulfonylethyl)ethanamine (PubChem CID 62584689) has the molecular formula C13H20ClNO3S and a molecular weight of 305.83 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-(2-methylsulfonylethyl)ethanamine.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(2-methylsulfonylethyl)ethanamine |
|---|---|
| PubChem CID | 62584689 |
| Molecular Formula | C13H20ClNO3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(2-methylsulfonylethyl)ethanamine |
| SMILES | Cc1cc(OCCNCCS(C)(=O)=O)cc(C)c1Cl |
| InChI | InChI=1S/C13H20ClNO3S/c1-10-8-12(9-11(2)13(10)14)18-6-4-15-5-7-19(3,16)17/h8-9,15H,4-7H2,1-3H3 |
| InChIKey | XERHIRFQVURSTC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|