C15H24ClNO2 — CID 2250138
2-[5-(4-chloro-3,5-dimethylphenoxy)pentylamino]ethanol (PubChem CID 2250138) has the molecular formula C15H24ClNO2 and a molecular weight of 285.81 g/mol. Its IUPAC name is 2-[5-(4-chloro-3,5-dimethylphenoxy)pentylamino]ethanol.
| Compound Name | 2-[5-(4-chloro-3,5-dimethylphenoxy)pentylamino]ethanol |
|---|---|
| PubChem CID | 2250138 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.81 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-[5-(4-chloro-3,5-dimethylphenoxy)pentylamino]ethanol |
| SMILES | Cc1cc(OCCCCCNCCO)cc(C)c1Cl |
| InChI | InChI=1S/C15H24ClNO2/c1-12-10-14(11-13(2)15(12)16)19-9-5-3-4-6-17-7-8-18/h10-11,17-18H,3-9H2,1-2H3 |
| InChIKey | CPCLOFLASZPHDE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|