C19H24ClNO3S — CID 113103120
N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-3-phenylpropane-1-sulfonamide (PubChem CID 113103120) has the molecular formula C19H24ClNO3S and a molecular weight of 381.93 g/mol. Its IUPAC name is N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-3-phenylpropane-1-sulfonamide.
| Compound Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-3-phenylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 113103120 |
| Molecular Formula | C19H24ClNO3S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-3-phenylpropane-1-sulfonamide |
| SMILES | Cc1cc(OCCNS(=O)(=O)CCCc2ccccc2)cc(C)c1Cl |
| InChI | InChI=1S/C19H24ClNO3S/c1-15-13-18(14-16(2)19(15)20)24-11-10-21-25(22,23)12-6-9-17-7-4-3-5-8-17/h3-5,7-8,13-14,21H,6,9-12H2,1-2H3 |
| InChIKey | ZDNXNPUULBRQSI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|