C19H24ClNO — CID 2182131
N-benzyl-3-(4-chloro-3,5-dimethylphenoxy)-N-methylpropan-1-amine (PubChem CID 2182131) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is N-benzyl-3-(4-chloro-3,5-dimethylphenoxy)-N-methylpropan-1-amine.
| Compound Name | N-benzyl-3-(4-chloro-3,5-dimethylphenoxy)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 2182131 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-benzyl-3-(4-chloro-3,5-dimethylphenoxy)-N-methylpropan-1-amine |
| SMILES | Cc1cc(OCCCN(C)Cc2ccccc2)cc(C)c1Cl |
| InChI | InChI=1S/C19H24ClNO/c1-15-12-18(13-16(2)19(15)20)22-11-7-10-21(3)14-17-8-5-4-6-9-17/h4-6,8-9,12-13H,7,10-11,14H2,1-3H3 |
| InChIKey | QAUWMYDJSQFXLZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|