C21H29NO — CID 2182140
N-benzyl-N-methyl-4-(2,3,5-trimethylphenoxy)butan-1-amine (PubChem CID 2182140) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-(2,3,5-trimethylphenoxy)butan-1-amine.
| Compound Name | N-benzyl-N-methyl-4-(2,3,5-trimethylphenoxy)butan-1-amine |
|---|---|
| PubChem CID | 2182140 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | N-benzyl-N-methyl-4-(2,3,5-trimethylphenoxy)butan-1-amine |
| SMILES | Cc1cc(C)c(C)c(OCCCCN(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H29NO/c1-17-14-18(2)19(3)21(15-17)23-13-9-8-12-22(4)16-20-10-6-5-7-11-20/h5-7,10-11,14-15H,8-9,12-13,16H2,1-4H3 |
| InChIKey | FQNSEYNUFBPCCV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|