C22H28BrNO5 — CID 2934341
N-benzyl-4-(4-bromo-2,6-dimethylphenoxy)-N-methylbutan-1-amine;oxalic acid (PubChem CID 2934341) has the molecular formula C22H28BrNO5 and a molecular weight of 466.37 g/mol. Its IUPAC name is N-benzyl-4-(4-bromo-2,6-dimethylphenoxy)-N-methylbutan-1-amine;oxalic acid.
| Compound Name | N-benzyl-4-(4-bromo-2,6-dimethylphenoxy)-N-methylbutan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2934341 |
| Molecular Formula | C22H28BrNO5 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-benzyl-4-(4-bromo-2,6-dimethylphenoxy)-N-methylbutan-1-amine;oxalic acid |
| SMILES | Cc1cc(Br)cc(C)c1OCCCCN(C)Cc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H26BrNO.C2H2O4/c1-16-13-19(21)14-17(2)20(16)23-12-8-7-11-22(3)15-18-9-5-4-6-10-18;3-1(4)2(5)6/h4-6,9-10,13-14H,7-8,11-12,15H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | FMEXIUSEJONNHX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|