C22H28ClNO5 — CID 2935170
N-benzyl-4-(4-chloro-2,3-dimethylphenoxy)-N-methylbutan-1-amine;oxalic acid (PubChem CID 2935170) has the molecular formula C22H28ClNO5 and a molecular weight of 421.92 g/mol. Its IUPAC name is N-benzyl-4-(4-chloro-2,3-dimethylphenoxy)-N-methylbutan-1-amine;oxalic acid.
| Compound Name | N-benzyl-4-(4-chloro-2,3-dimethylphenoxy)-N-methylbutan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2935170 |
| Molecular Formula | C22H28ClNO5 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-benzyl-4-(4-chloro-2,3-dimethylphenoxy)-N-methylbutan-1-amine;oxalic acid |
| SMILES | Cc1c(Cl)ccc(OCCCCN(C)Cc2ccccc2)c1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H26ClNO.C2H2O4/c1-16-17(2)20(12-11-19(16)21)23-14-8-7-13-22(3)15-18-9-5-4-6-10-18;3-1(4)2(5)6/h4-6,9-12H,7-8,13-15H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | WPCRZHMUJWMUHM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|