C21H27NO5 — CID 70694657
N-benzyl-N-methyl-2-(3-phenylpropoxy)ethanamine;oxalic acid (PubChem CID 70694657) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-(3-phenylpropoxy)ethanamine;oxalic acid.
| Compound Name | N-benzyl-N-methyl-2-(3-phenylpropoxy)ethanamine;oxalic acid |
|---|---|
| PubChem CID | 70694657 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-benzyl-N-methyl-2-(3-phenylpropoxy)ethanamine;oxalic acid |
| SMILES | CN(CCOCCCc1ccccc1)Cc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H25NO.C2H2O4/c1-20(17-19-11-6-3-7-12-19)14-16-21-15-8-13-18-9-4-2-5-10-18;3-1(4)2(5)6/h2-7,9-12H,8,13-17H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JHFJCYQSFOZPIA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|