C23H41NO7 — CID 176613357
3-[2-[2-[2-[2-[2-[2-[benzyl(methyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-1-ol (PubChem CID 176613357) has the molecular formula C23H41NO7 and a molecular weight of 443.58 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[2-[2-[benzyl(methyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-1-ol.
| Compound Name | 3-[2-[2-[2-[2-[2-[2-[benzyl(methyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-1-ol |
|---|---|
| PubChem CID | 176613357 |
| Molecular Formula | C23H41NO7 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 3-[2-[2-[2-[2-[2-[2-[benzyl(methyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-1-ol |
| SMILES | CN(CCOCCOCCOCCOCCOCCOCCCO)Cc1ccccc1 |
| InChI | InChI=1S/C23H41NO7/c1-24(22-23-6-3-2-4-7-23)8-11-27-13-15-29-17-19-31-21-20-30-18-16-28-14-12-26-10-5-9-25/h2-4,6-7,25H,5,8-22H2,1H3 |
| InChIKey | XIYQWGXIKSXSAO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|