2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate

C18H19BrO3 — CID 4945265

IUPAC2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate
SMILESCc1cc(Br)cc(C)c1OCC(=O)OCCc1ccccc1
InChIInChI=1S/C18H19BrO3/c1-13-10-16(19)11-14(2)18(13)22-12-17(20)21-9-8-15-6-4-3-5-7-15/h3-7,10-11H,8-9,12H2,1-2H3
InChIKeyNOFOLIAFERRBQR-UHFFFAOYSA-N
MW363.25 g/mol
LogP4.23
Rot. Bonds6

About 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate

2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate (PubChem CID 4945265) has the molecular formula C18H19BrO3 and a molecular weight of 363.25 g/mol. Its IUPAC name is 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate.

Molecular Properties

Compound Name2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate
PubChem CID4945265
Molecular FormulaC18H19BrO3
Molecular Weight363.25 g/mol
Exact Mass362.05
IUPAC Name2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate
SMILESCc1cc(Br)cc(C)c1OCC(=O)OCCc1ccccc1
InChIInChI=1S/C18H19BrO3/c1-13-10-16(19)11-14(2)18(13)22-12-17(20)21-9-8-15-6-4-3-5-7-15/h3-7,10-11H,8-9,12H2,1-2H3
InChIKeyNOFOLIAFERRBQR-UHFFFAOYSA-N
XLogP4.23
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.25
LogP ≤ 54.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate?
The IUPAC name of 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate (CID 4945265) is 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate.
What is the SMILES notation for 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate?
The canonical SMILES for 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate is Cc1cc(Br)cc(C)c1OCC(=O)OCCc1ccccc1.
What is the InChIKey of 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate?
The InChIKey is NOFOLIAFERRBQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrO3/c1-13-10-16(19)11-14(2)18(13)22-12-17(20)21-9-8-15-6-4-3-5-7-15/h3-7,10-11H,8-9,12H2,1-2H3.
What are the key properties of 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate?
2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate has a molecular weight of 363.25 g/mol, XLogP of 4.23, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate is sourced from PubChem (CID 4945265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).