C18H19BrO3 — CID 4945265
2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate (PubChem CID 4945265) has the molecular formula C18H19BrO3 and a molecular weight of 363.25 g/mol. Its IUPAC name is 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate.
| Compound Name | 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 4945265 |
| Molecular Formula | C18H19BrO3 |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 2-phenylethyl 2-(4-bromo-2,6-dimethylphenoxy)acetate |
| SMILES | Cc1cc(Br)cc(C)c1OCC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C18H19BrO3/c1-13-10-16(19)11-14(2)18(13)22-12-17(20)21-9-8-15-6-4-3-5-7-15/h3-7,10-11H,8-9,12H2,1-2H3 |
| InChIKey | NOFOLIAFERRBQR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |