C15H26N2O3S — CID 62583401
N,N-diethyl-3-[2-(2-methylsulfonylethylamino)ethoxy]aniline (PubChem CID 62583401) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is N,N-diethyl-3-[2-(2-methylsulfonylethylamino)ethoxy]aniline.
| Compound Name | N,N-diethyl-3-[2-(2-methylsulfonylethylamino)ethoxy]aniline |
|---|---|
| PubChem CID | 62583401 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N,N-diethyl-3-[2-(2-methylsulfonylethylamino)ethoxy]aniline |
| SMILES | CCN(CC)c1cccc(OCCNCCS(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H26N2O3S/c1-4-17(5-2)14-7-6-8-15(13-14)20-11-9-16-10-12-21(3,18)19/h6-8,13,16H,4-5,9-12H2,1-3H3 |
| InChIKey | YXHXVIZBUOCRLR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|