C15H25NO — CID 163281862
3-(5-deuteriopentoxy)-N,N-diethylaniline (PubChem CID 163281862) has the molecular formula C15H25NO and a molecular weight of 236.38 g/mol. Its IUPAC name is 3-(5-deuteriopentoxy)-N,N-diethylaniline.
| Compound Name | 3-(5-deuteriopentoxy)-N,N-diethylaniline |
|---|---|
| PubChem CID | 163281862 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 3-(5-deuteriopentoxy)-N,N-diethylaniline |
| SMILES | [2H]CCCCCOc1cccc(N(CC)CC)c1 |
| InChI | InChI=1S/C15H25NO/c1-4-7-8-12-17-15-11-9-10-14(13-15)16(5-2)6-3/h9-11,13H,4-8,12H2,1-3H3/i1D |
| InChIKey | SKNGWALGKBQFEE-MICDWDOJSA-N |
| XLogP | 4.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|