C10H13F2NO — CID 81269290
3-(2,6-difluorophenoxy)-N-methylpropan-1-amine (PubChem CID 81269290) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 3-(2,6-difluorophenoxy)-N-methylpropan-1-amine.
| Compound Name | 3-(2,6-difluorophenoxy)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 81269290 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 3-(2,6-difluorophenoxy)-N-methylpropan-1-amine |
| SMILES | CNCCCOc1c(F)cccc1F |
| InChI | InChI=1S/C10H13F2NO/c1-13-6-3-7-14-10-8(11)4-2-5-9(10)12/h2,4-5,13H,3,6-7H2,1H3 |
| InChIKey | BQHAFTXEVNCIIW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|