C11H13F4NO — CID 103290253
N-methyl-4-(2,3,5,6-tetrafluorophenoxy)butan-1-amine (PubChem CID 103290253) has the molecular formula C11H13F4NO and a molecular weight of 251.22 g/mol. Its IUPAC name is N-methyl-4-(2,3,5,6-tetrafluorophenoxy)butan-1-amine.
| Compound Name | N-methyl-4-(2,3,5,6-tetrafluorophenoxy)butan-1-amine |
|---|---|
| PubChem CID | 103290253 |
| Molecular Formula | C11H13F4NO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-methyl-4-(2,3,5,6-tetrafluorophenoxy)butan-1-amine |
| SMILES | CNCCCCOc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H13F4NO/c1-16-4-2-3-5-17-11-9(14)7(12)6-8(13)10(11)15/h6,16H,2-5H2,1H3 |
| InChIKey | LUBIAFPLGDPEDB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|