C11H13F4NO2 — CID 103290282
2-methoxy-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]ethanamine (PubChem CID 103290282) has the molecular formula C11H13F4NO2 and a molecular weight of 267.22 g/mol. Its IUPAC name is 2-methoxy-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]ethanamine.
| Compound Name | 2-methoxy-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 103290282 |
| Molecular Formula | C11H13F4NO2 |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-methoxy-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]ethanamine |
| SMILES | COCCNCCOc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H13F4NO2/c1-17-4-2-16-3-5-18-11-9(14)7(12)6-8(13)10(11)15/h6,16H,2-5H2,1H3 |
| InChIKey | QYDIJYHWONTPPH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|