C17H12F9NO2 — CID 156647654
N-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]-2-(2,3,5,6-tetrafluoro-4-methylphenoxy)ethanamine (PubChem CID 156647654) has the molecular formula C17H12F9NO2 and a molecular weight of 433.27 g/mol. Its IUPAC name is N-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]-2-(2,3,5,6-tetrafluoro-4-methylphenoxy)ethanamine.
| Compound Name | N-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]-2-(2,3,5,6-tetrafluoro-4-methylphenoxy)ethanamine |
|---|---|
| PubChem CID | 156647654 |
| Molecular Formula | C17H12F9NO2 |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | N-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]-2-(2,3,5,6-tetrafluoro-4-methylphenoxy)ethanamine |
| SMILES | Cc1c(F)c(F)c(OCCNCCOc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C17H12F9NO2/c1-6-7(18)12(23)16(13(24)8(6)19)28-4-2-27-3-5-29-17-14(25)10(21)9(20)11(22)15(17)26/h27H,2-5H2,1H3 |
| InChIKey | UZCBWVYAGCQTSE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|