C15H18Br2ClNO — CID 107745493
6-[2,6-dibromo-4-(chloromethyl)phenoxy]-2,2-dimethylhexanenitrile (PubChem CID 107745493) has the molecular formula C15H18Br2ClNO and a molecular weight of 423.58 g/mol. Its IUPAC name is 6-[2,6-dibromo-4-(chloromethyl)phenoxy]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[2,6-dibromo-4-(chloromethyl)phenoxy]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 107745493 |
| Molecular Formula | C15H18Br2ClNO |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 420.94 |
| IUPAC Name | 6-[2,6-dibromo-4-(chloromethyl)phenoxy]-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCOc1c(Br)cc(CCl)cc1Br |
| InChI | InChI=1S/C15H18Br2ClNO/c1-15(2,10-19)5-3-4-6-20-14-12(16)7-11(9-18)8-13(14)17/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | HMCXEXWDSRIMMV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|