C16H21Br2NO2 — CID 106713067
6-[2-bromo-4-(bromomethyl)-6-methoxyphenoxy]-2,2-dimethylhexanenitrile (PubChem CID 106713067) has the molecular formula C16H21Br2NO2 and a molecular weight of 419.16 g/mol. Its IUPAC name is 6-[2-bromo-4-(bromomethyl)-6-methoxyphenoxy]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[2-bromo-4-(bromomethyl)-6-methoxyphenoxy]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106713067 |
| Molecular Formula | C16H21Br2NO2 |
| Molecular Weight | 419.16 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | 6-[2-bromo-4-(bromomethyl)-6-methoxyphenoxy]-2,2-dimethylhexanenitrile |
| SMILES | COc1cc(CBr)cc(Br)c1OCCCCC(C)(C)C#N |
| InChI | InChI=1S/C16H21Br2NO2/c1-16(2,11-19)6-4-5-7-21-15-13(18)8-12(10-17)9-14(15)20-3/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | GATCOZAAQZYAGM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.16 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|