C14H16BrF2NO — CID 106710547
6-(2-bromo-4,6-difluorophenoxy)-2,2-dimethylhexanenitrile (PubChem CID 106710547) has the molecular formula C14H16BrF2NO and a molecular weight of 332.19 g/mol. Its IUPAC name is 6-(2-bromo-4,6-difluorophenoxy)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(2-bromo-4,6-difluorophenoxy)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106710547 |
| Molecular Formula | C14H16BrF2NO |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 6-(2-bromo-4,6-difluorophenoxy)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCOc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C14H16BrF2NO/c1-14(2,9-18)5-3-4-6-19-13-11(15)7-10(16)8-12(13)17/h7-8H,3-6H2,1-2H3 |
| InChIKey | LKRYOQMVEAGPKU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|