C12H13BrFNO — CID 65253440
4-(2-bromo-4-fluorophenoxy)-2,2-dimethylbutanenitrile (PubChem CID 65253440) has the molecular formula C12H13BrFNO and a molecular weight of 286.14 g/mol. Its IUPAC name is 4-(2-bromo-4-fluorophenoxy)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(2-bromo-4-fluorophenoxy)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65253440 |
| Molecular Formula | C12H13BrFNO |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 4-(2-bromo-4-fluorophenoxy)-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCOc1ccc(F)cc1Br |
| InChI | InChI=1S/C12H13BrFNO/c1-12(2,8-15)5-6-16-11-4-3-9(14)7-10(11)13/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | JMNUYJPXHFXSIT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |