C13H14FNO3 — CID 107690116
4-(3-cyano-3-methylbutoxy)-3-fluorobenzoic acid (PubChem CID 107690116) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is 4-(3-cyano-3-methylbutoxy)-3-fluorobenzoic acid.
| Compound Name | 4-(3-cyano-3-methylbutoxy)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 107690116 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 4-(3-cyano-3-methylbutoxy)-3-fluorobenzoic acid |
| SMILES | CC(C)(C#N)CCOc1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C13H14FNO3/c1-13(2,8-15)5-6-18-11-4-3-9(12(16)17)7-10(11)14/h3-4,7H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | VKNDWYIDNXLCAR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |