C16H22FNO2 — CID 106712998
6-[2-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-2,2-dimethylhexanenitrile (PubChem CID 106712998) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is 6-[2-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[2-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106712998 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 6-[2-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-2,2-dimethylhexanenitrile |
| SMILES | C[C@H](O)c1ccc(OCCCCC(C)(C)C#N)c(F)c1 |
| InChI | InChI=1S/C16H22FNO2/c1-12(19)13-6-7-15(14(17)10-13)20-9-5-4-8-16(2,3)11-18/h6-7,10,12,19H,4-5,8-9H2,1-3H3/t12-/m0/s1 |
| InChIKey | MRIBHGVTZZNOCS-LBPRGKRZSA-N |
| XLogP | 3.98 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|