C15H18FNO2 — CID 106832439
6-(2-fluoro-4-formylphenoxy)-2,2-dimethylhexanenitrile (PubChem CID 106832439) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is 6-(2-fluoro-4-formylphenoxy)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(2-fluoro-4-formylphenoxy)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106832439 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6-(2-fluoro-4-formylphenoxy)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCOc1ccc(C=O)cc1F |
| InChI | InChI=1S/C15H18FNO2/c1-15(2,11-17)7-3-4-8-19-14-6-5-12(10-18)9-13(14)16/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | ALHFTGZBGHDFIZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|