C17H23NO2 — CID 106710634
6-(4-formyl-2,6-dimethylphenoxy)-2,2-dimethylhexanenitrile (PubChem CID 106710634) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 6-(4-formyl-2,6-dimethylphenoxy)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-formyl-2,6-dimethylphenoxy)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106710634 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 6-(4-formyl-2,6-dimethylphenoxy)-2,2-dimethylhexanenitrile |
| SMILES | Cc1cc(C=O)cc(C)c1OCCCCC(C)(C)C#N |
| InChI | InChI=1S/C17H23NO2/c1-13-9-15(11-19)10-14(2)16(13)20-8-6-5-7-17(3,4)12-18/h9-11H,5-8H2,1-4H3 |
| InChIKey | MUMLKFMZWYBPHC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|