C14H16FNO2 — CID 79035303
4-(2-acetyl-4-fluorophenoxy)-2,2-dimethylbutanenitrile (PubChem CID 79035303) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is 4-(2-acetyl-4-fluorophenoxy)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(2-acetyl-4-fluorophenoxy)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 79035303 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 4-(2-acetyl-4-fluorophenoxy)-2,2-dimethylbutanenitrile |
| SMILES | CC(=O)c1cc(F)ccc1OCCC(C)(C)C#N |
| InChI | InChI=1S/C14H16FNO2/c1-10(17)12-8-11(15)4-5-13(12)18-7-6-14(2,3)9-16/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | IOLWNHCXPUZBBL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |