C13H16BrNO — CID 65253546
4-(4-bromo-2-methylphenoxy)-2,2-dimethylbutanenitrile (PubChem CID 65253546) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is 4-(4-bromo-2-methylphenoxy)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(4-bromo-2-methylphenoxy)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65253546 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-(4-bromo-2-methylphenoxy)-2,2-dimethylbutanenitrile |
| SMILES | Cc1cc(Br)ccc1OCCC(C)(C)C#N |
| InChI | InChI=1S/C13H16BrNO/c1-10-8-11(14)4-5-12(10)16-7-6-13(2,3)9-15/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | QNHJBDLRUGOPOG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |