C16H23BrN2O — CID 106713599
6-[2-(2-aminoethyl)-4-bromophenoxy]-2,2-dimethylhexanenitrile (PubChem CID 106713599) has the molecular formula C16H23BrN2O and a molecular weight of 339.28 g/mol. Its IUPAC name is 6-[2-(2-aminoethyl)-4-bromophenoxy]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[2-(2-aminoethyl)-4-bromophenoxy]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106713599 |
| Molecular Formula | C16H23BrN2O |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 6-[2-(2-aminoethyl)-4-bromophenoxy]-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCOc1ccc(Br)cc1CCN |
| InChI | InChI=1S/C16H23BrN2O/c1-16(2,12-19)8-3-4-10-20-15-6-5-14(17)11-13(15)7-9-18/h5-6,11H,3-4,7-10,18H2,1-2H3 |
| InChIKey | AWNXMJNLJAUWEJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|