C15H19BrFNO — CID 106713091
6-[3-(bromomethyl)-5-fluorophenoxy]-2,2-dimethylhexanenitrile (PubChem CID 106713091) has the molecular formula C15H19BrFNO and a molecular weight of 328.23 g/mol. Its IUPAC name is 6-[3-(bromomethyl)-5-fluorophenoxy]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[3-(bromomethyl)-5-fluorophenoxy]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106713091 |
| Molecular Formula | C15H19BrFNO |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 6-[3-(bromomethyl)-5-fluorophenoxy]-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCOc1cc(F)cc(CBr)c1 |
| InChI | InChI=1S/C15H19BrFNO/c1-15(2,11-18)5-3-4-6-19-14-8-12(10-16)7-13(17)9-14/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | YGRPNZOSXPTRJK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|