C15H18FNO3 — CID 107675216
4-(5-cyano-5-methylhexoxy)-2-fluorobenzoic acid (PubChem CID 107675216) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is 4-(5-cyano-5-methylhexoxy)-2-fluorobenzoic acid.
| Compound Name | 4-(5-cyano-5-methylhexoxy)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 107675216 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-(5-cyano-5-methylhexoxy)-2-fluorobenzoic acid |
| SMILES | CC(C)(C#N)CCCCOc1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C15H18FNO3/c1-15(2,10-17)7-3-4-8-20-11-5-6-12(14(18)19)13(16)9-11/h5-6,9H,3-4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | YRBHHQZZYLXKHQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|