C14H20N2O — CID 106708279
6-(4-aminophenoxy)-2,2-dimethylhexanenitrile (PubChem CID 106708279) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 6-(4-aminophenoxy)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-aminophenoxy)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106708279 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 6-(4-aminophenoxy)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCOc1ccc(N)cc1 |
| InChI | InChI=1S/C14H20N2O/c1-14(2,11-15)9-3-4-10-17-13-7-5-12(16)6-8-13/h5-8H,3-4,9-10,16H2,1-2H3 |
| InChIKey | CHXHASOKYQPYTC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|