C18H26N4O2 — CID 172559201
1,6-bis(4-aminophenoxy)hexane-1,1-diamine (PubChem CID 172559201) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1,6-bis(4-aminophenoxy)hexane-1,1-diamine.
| Compound Name | 1,6-bis(4-aminophenoxy)hexane-1,1-diamine |
|---|---|
| PubChem CID | 172559201 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1,6-bis(4-aminophenoxy)hexane-1,1-diamine |
| SMILES | Nc1ccc(OCCCCCC(N)(N)Oc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C18H26N4O2/c19-14-4-8-16(9-5-14)23-13-3-1-2-12-18(21,22)24-17-10-6-15(20)7-11-17/h4-11H,1-3,12-13,19-22H2 |
| InChIKey | ORNZEUJECNDQJC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|