C14H18N4O2 — CID 141003023
1,2-bis(4-aminophenoxy)ethane-1,1-diamine (PubChem CID 141003023) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1,2-bis(4-aminophenoxy)ethane-1,1-diamine.
| Compound Name | 1,2-bis(4-aminophenoxy)ethane-1,1-diamine |
|---|---|
| PubChem CID | 141003023 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1,2-bis(4-aminophenoxy)ethane-1,1-diamine |
| SMILES | Nc1ccc(OCC(N)(N)Oc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C14H18N4O2/c15-10-1-5-12(6-2-10)19-9-14(17,18)20-13-7-3-11(16)4-8-13/h1-8H,9,15-18H2 |
| InChIKey | KQIWHLWDQIVWLR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|