About 4-(azidomethoxy)aniline
4-(azidomethoxy)aniline (PubChem CID 152728355) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 4-(azidomethoxy)aniline.
Molecular Properties
| Compound Name | 4-(azidomethoxy)aniline |
| PubChem CID | 152728355 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 4-(azidomethoxy)aniline |
| SMILES | [N-]=[N+]=NCOc1ccc(N)cc1 |
| InChI | InChI=1S/C7H8N4O/c8-6-1-3-7(4-2-6)12-5-10-11-9/h1-4H,5,8H2 |
| InChIKey | ZXBSQMBZQYBLAC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(azidomethoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azidomethoxy)aniline?
The IUPAC name of 4-(azidomethoxy)aniline (CID 152728355) is 4-(azidomethoxy)aniline.
What is the SMILES notation for 4-(azidomethoxy)aniline?
The canonical SMILES for 4-(azidomethoxy)aniline is [N-]=[N+]=NCOc1ccc(N)cc1.
What is the InChIKey of 4-(azidomethoxy)aniline?
The InChIKey is ZXBSQMBZQYBLAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c8-6-1-3-7(4-2-6)12-5-10-11-9/h1-4H,5,8H2.
What are the key properties of 4-(azidomethoxy)aniline?
4-(azidomethoxy)aniline has a molecular weight of 164.17 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azidomethoxy)aniline is sourced from PubChem (CID 152728355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).