C20H23NO6 — CID 102321827
5-[6-(4-aminophenoxy)hexoxy]benzene-1,3-dicarboxylic acid (PubChem CID 102321827) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is 5-[6-(4-aminophenoxy)hexoxy]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[6-(4-aminophenoxy)hexoxy]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 102321827 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 5-[6-(4-aminophenoxy)hexoxy]benzene-1,3-dicarboxylic acid |
| SMILES | Nc1ccc(OCCCCCCOc2cc(C(=O)O)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H23NO6/c21-16-5-7-17(8-6-16)26-9-3-1-2-4-10-27-18-12-14(19(22)23)11-15(13-18)20(24)25/h5-8,11-13H,1-4,9-10,21H2,(H,22,23)(H,24,25) |
| InChIKey | PNHQSLVXSCUFAF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|