C13H16Br2O2 — CID 107738096
3,5-dibromo-4-(3,3-dimethylbutoxy)benzaldehyde (PubChem CID 107738096) has the molecular formula C13H16Br2O2 and a molecular weight of 364.08 g/mol. Its IUPAC name is 3,5-dibromo-4-(3,3-dimethylbutoxy)benzaldehyde.
| Compound Name | 3,5-dibromo-4-(3,3-dimethylbutoxy)benzaldehyde |
|---|---|
| PubChem CID | 107738096 |
| Molecular Formula | C13H16Br2O2 |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 3,5-dibromo-4-(3,3-dimethylbutoxy)benzaldehyde |
| SMILES | CC(C)(C)CCOc1c(Br)cc(C=O)cc1Br |
| InChI | InChI=1S/C13H16Br2O2/c1-13(2,3)4-5-17-12-10(14)6-9(8-16)7-11(12)15/h6-8H,4-5H2,1-3H3 |
| InChIKey | DICBWXLPJMSIMO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|