C13H16Br2O4 — CID 107738282
3,5-dibromo-4-[3-(2-methoxyethoxy)propoxy]benzaldehyde (PubChem CID 107738282) has the molecular formula C13H16Br2O4 and a molecular weight of 396.08 g/mol. Its IUPAC name is 3,5-dibromo-4-[3-(2-methoxyethoxy)propoxy]benzaldehyde.
| Compound Name | 3,5-dibromo-4-[3-(2-methoxyethoxy)propoxy]benzaldehyde |
|---|---|
| PubChem CID | 107738282 |
| Molecular Formula | C13H16Br2O4 |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | 3,5-dibromo-4-[3-(2-methoxyethoxy)propoxy]benzaldehyde |
| SMILES | COCCOCCCOc1c(Br)cc(C=O)cc1Br |
| InChI | InChI=1S/C13H16Br2O4/c1-17-5-6-18-3-2-4-19-13-11(14)7-10(9-16)8-12(13)15/h7-9H,2-6H2,1H3 |
| InChIKey | JYUDUJCHOCVZBK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|