C15H19Br2ClO — CID 114191448
1,3-dibromo-5-(chloromethyl)-2-(2-cyclohexylethoxy)benzene (PubChem CID 114191448) has the molecular formula C15H19Br2ClO and a molecular weight of 410.58 g/mol. Its IUPAC name is 1,3-dibromo-5-(chloromethyl)-2-(2-cyclohexylethoxy)benzene.
| Compound Name | 1,3-dibromo-5-(chloromethyl)-2-(2-cyclohexylethoxy)benzene |
|---|---|
| PubChem CID | 114191448 |
| Molecular Formula | C15H19Br2ClO |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | 1,3-dibromo-5-(chloromethyl)-2-(2-cyclohexylethoxy)benzene |
| SMILES | ClCc1cc(Br)c(OCCC2CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C15H19Br2ClO/c16-13-8-12(10-18)9-14(17)15(13)19-7-6-11-4-2-1-3-5-11/h8-9,11H,1-7,10H2 |
| InChIKey | UHQPHKFMMONZJJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|