C12H13Br2ClO2 — CID 107745321
4-[2,6-dibromo-4-(chloromethyl)phenoxy]oxane (PubChem CID 107745321) has the molecular formula C12H13Br2ClO2 and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-[2,6-dibromo-4-(chloromethyl)phenoxy]oxane.
| Compound Name | 4-[2,6-dibromo-4-(chloromethyl)phenoxy]oxane |
|---|---|
| PubChem CID | 107745321 |
| Molecular Formula | C12H13Br2ClO2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 381.90 |
| IUPAC Name | 4-[2,6-dibromo-4-(chloromethyl)phenoxy]oxane |
| SMILES | ClCc1cc(Br)c(OC2CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C12H13Br2ClO2/c13-10-5-8(7-15)6-11(14)12(10)17-9-1-3-16-4-2-9/h5-6,9H,1-4,7H2 |
| InChIKey | HDABKBOJVPGDLQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|