C14H19ClO2 — CID 63936243
4-[4-(chloromethyl)-2,6-dimethylphenoxy]oxane (PubChem CID 63936243) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is 4-[4-(chloromethyl)-2,6-dimethylphenoxy]oxane.
| Compound Name | 4-[4-(chloromethyl)-2,6-dimethylphenoxy]oxane |
|---|---|
| PubChem CID | 63936243 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-[4-(chloromethyl)-2,6-dimethylphenoxy]oxane |
| SMILES | Cc1cc(CCl)cc(C)c1OC1CCOCC1 |
| InChI | InChI=1S/C14H19ClO2/c1-10-7-12(9-15)8-11(2)14(10)17-13-3-5-16-6-4-13/h7-8,13H,3-6,9H2,1-2H3 |
| InChIKey | FOZCTZZQOQZNJC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|