C13H17ClO3S — CID 54914785
3-[4-(chloromethyl)-2,6-dimethylphenoxy]thiolane 1,1-dioxide (PubChem CID 54914785) has the molecular formula C13H17ClO3S and a molecular weight of 288.80 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-2,6-dimethylphenoxy]thiolane 1,1-dioxide.
| Compound Name | 3-[4-(chloromethyl)-2,6-dimethylphenoxy]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 54914785 |
| Molecular Formula | C13H17ClO3S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 3-[4-(chloromethyl)-2,6-dimethylphenoxy]thiolane 1,1-dioxide |
| SMILES | Cc1cc(CCl)cc(C)c1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17ClO3S/c1-9-5-11(7-14)6-10(2)13(9)17-12-3-4-18(15,16)8-12/h5-6,12H,3-4,7-8H2,1-2H3 |
| InChIKey | ZRYAKXKFSQLAAV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|