C12H14BrClO4S — CID 54914834
3-[4-(bromomethyl)-2-chloro-6-methoxyphenoxy]thiolane 1,1-dioxide (PubChem CID 54914834) has the molecular formula C12H14BrClO4S and a molecular weight of 369.66 g/mol. Its IUPAC name is 3-[4-(bromomethyl)-2-chloro-6-methoxyphenoxy]thiolane 1,1-dioxide.
| Compound Name | 3-[4-(bromomethyl)-2-chloro-6-methoxyphenoxy]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 54914834 |
| Molecular Formula | C12H14BrClO4S |
| Molecular Weight | 369.66 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 3-[4-(bromomethyl)-2-chloro-6-methoxyphenoxy]thiolane 1,1-dioxide |
| SMILES | COc1cc(CBr)cc(Cl)c1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14BrClO4S/c1-17-11-5-8(6-13)4-10(14)12(11)18-9-2-3-19(15,16)7-9/h4-5,9H,2-3,6-7H2,1H3 |
| InChIKey | SMZFIADANGITGD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.66 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|