C14H20BrNO4S — CID 61057141
2-[3-bromo-4-(1,1-dioxothiolan-3-yl)oxy-5-ethoxyphenyl]ethanamine (PubChem CID 61057141) has the molecular formula C14H20BrNO4S and a molecular weight of 378.29 g/mol. Its IUPAC name is 2-[3-bromo-4-(1,1-dioxothiolan-3-yl)oxy-5-ethoxyphenyl]ethanamine.
| Compound Name | 2-[3-bromo-4-(1,1-dioxothiolan-3-yl)oxy-5-ethoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 61057141 |
| Molecular Formula | C14H20BrNO4S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2-[3-bromo-4-(1,1-dioxothiolan-3-yl)oxy-5-ethoxyphenyl]ethanamine |
| SMILES | CCOc1cc(CCN)cc(Br)c1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20BrNO4S/c1-2-19-13-8-10(3-5-16)7-12(15)14(13)20-11-4-6-21(17,18)9-11/h7-8,11H,2-6,9,16H2,1H3 |
| InChIKey | DPNFWRVQMYQKEU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |