C12H16BrNO3S — CID 61392040
2-[3-bromo-2-(1,1-dioxothiolan-3-yl)oxyphenyl]ethanamine (PubChem CID 61392040) has the molecular formula C12H16BrNO3S and a molecular weight of 334.24 g/mol. Its IUPAC name is 2-[3-bromo-2-(1,1-dioxothiolan-3-yl)oxyphenyl]ethanamine.
| Compound Name | 2-[3-bromo-2-(1,1-dioxothiolan-3-yl)oxyphenyl]ethanamine |
|---|---|
| PubChem CID | 61392040 |
| Molecular Formula | C12H16BrNO3S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2-[3-bromo-2-(1,1-dioxothiolan-3-yl)oxyphenyl]ethanamine |
| SMILES | NCCc1cccc(Br)c1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H16BrNO3S/c13-11-3-1-2-9(4-6-14)12(11)17-10-5-7-18(15,16)8-10/h1-3,10H,4-8,14H2 |
| InChIKey | FYVNQDYTYFCPFN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |