C11H13BrO3S — CID 61058893
3-[2-(bromomethyl)phenoxy]thiolane 1,1-dioxide (PubChem CID 61058893) has the molecular formula C11H13BrO3S and a molecular weight of 305.19 g/mol. Its IUPAC name is 3-[2-(bromomethyl)phenoxy]thiolane 1,1-dioxide.
| Compound Name | 3-[2-(bromomethyl)phenoxy]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 61058893 |
| Molecular Formula | C11H13BrO3S |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 3-[2-(bromomethyl)phenoxy]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Oc2ccccc2CBr)C1 |
| InChI | InChI=1S/C11H13BrO3S/c12-7-9-3-1-2-4-11(9)15-10-5-6-16(13,14)8-10/h1-4,10H,5-8H2 |
| InChIKey | NAZRGWYGLRCBCM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|