C11H14ClNO3S — CID 113276602
[2-chloro-6-(1,1-dioxothiolan-3-yl)oxyphenyl]methanamine (PubChem CID 113276602) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is [2-chloro-6-(1,1-dioxothiolan-3-yl)oxyphenyl]methanamine.
| Compound Name | [2-chloro-6-(1,1-dioxothiolan-3-yl)oxyphenyl]methanamine |
|---|---|
| PubChem CID | 113276602 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | [2-chloro-6-(1,1-dioxothiolan-3-yl)oxyphenyl]methanamine |
| SMILES | NCc1c(Cl)cccc1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H14ClNO3S/c12-10-2-1-3-11(9(10)6-13)16-8-4-5-17(14,15)7-8/h1-3,8H,4-7,13H2 |
| InChIKey | CDBRSCNFJUOSEB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |