C16H25NO3S — CID 61057921
1-[4-(1,1-dioxothiolan-3-yl)oxy-3,5-dimethylphenyl]butan-2-amine (PubChem CID 61057921) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 1-[4-(1,1-dioxothiolan-3-yl)oxy-3,5-dimethylphenyl]butan-2-amine.
| Compound Name | 1-[4-(1,1-dioxothiolan-3-yl)oxy-3,5-dimethylphenyl]butan-2-amine |
|---|---|
| PubChem CID | 61057921 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-[4-(1,1-dioxothiolan-3-yl)oxy-3,5-dimethylphenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(C)c(OC2CCS(=O)(=O)C2)c(C)c1 |
| InChI | InChI=1S/C16H25NO3S/c1-4-14(17)9-13-7-11(2)16(12(3)8-13)20-15-5-6-21(18,19)10-15/h7-8,14-15H,4-6,9-10,17H2,1-3H3 |
| InChIKey | REAZGXSQGPUIOZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |