C15H23NO4S — CID 61057800
1-[2-(1,1-dioxothiolan-3-yl)oxy-5-methoxyphenyl]butan-2-amine (PubChem CID 61057800) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-[2-(1,1-dioxothiolan-3-yl)oxy-5-methoxyphenyl]butan-2-amine.
| Compound Name | 1-[2-(1,1-dioxothiolan-3-yl)oxy-5-methoxyphenyl]butan-2-amine |
|---|---|
| PubChem CID | 61057800 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-[2-(1,1-dioxothiolan-3-yl)oxy-5-methoxyphenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(OC)ccc1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H23NO4S/c1-3-12(16)8-11-9-13(19-2)4-5-15(11)20-14-6-7-21(17,18)10-14/h4-5,9,12,14H,3,6-8,10,16H2,1-2H3 |
| InChIKey | VKRMORIOGXCFCD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |