C12H16O5S — CID 99975160
2-[(3S)-1,1-dioxothiolan-3-yl]oxy-5-ethoxyphenol (PubChem CID 99975160) has the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]oxy-5-ethoxyphenol.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]oxy-5-ethoxyphenol |
|---|---|
| PubChem CID | 99975160 |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]oxy-5-ethoxyphenol |
| SMILES | CCOc1ccc(O[C@H]2CCS(=O)(=O)C2)c(O)c1 |
| InChI | InChI=1S/C12H16O5S/c1-2-16-9-3-4-12(11(13)7-9)17-10-5-6-18(14,15)8-10/h3-4,7,10,13H,2,5-6,8H2,1H3/t10-/m0/s1 |
| InChIKey | KXAVIPSDGAULLO-JTQLQIEISA-N |
| XLogP | 1.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |