C12H16N2O4S — CID 54914693
4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzenecarboximidamide (PubChem CID 54914693) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzenecarboximidamide.
| Compound Name | 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 54914693 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OC2CCS(=O)(=O)C2)c(OC)c1 |
| InChI | InChI=1S/C12H16N2O4S/c1-17-11-6-8(12(13)14)2-3-10(11)18-9-4-5-19(15,16)7-9/h2-3,6,9H,4-5,7H2,1H3,(H3,13,14) |
| InChIKey | JMPWQLYLDOQNIG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|